C22H31N3O3 — CID 164688724
(1R,2S,8S,9S)-11-(2-ethyl-6-oxo-1H-pyridine-3-carbonyl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164688724) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-(2-ethyl-6-oxo-1H-pyridine-3-carbonyl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-(2-ethyl-6-oxo-1H-pyridine-3-carbonyl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164688724 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (1R,2S,8S,9S)-11-(2-ethyl-6-oxo-1H-pyridine-3-carbonyl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(C(=O)c3ccc(=O)[nH]c3CC)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C22H31N3O3/c1-3-6-18-14-11-15(19-7-5-8-21(27)25(18)19)13-24(12-14)22(28)16-9-10-20(26)23-17(16)4-2/h9-10,14-15,18-19H,3-8,11-13H2,1-2H3,(H,23,26)/t14-,15+,18-,19-/m0/s1 |
| InChIKey | BEURIVXJXAHWDD-QXGSTGNESA-N |
| XLogP | 2.58 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |