C20H28N2O3 — CID 164695383
(4S,5S)-9-[(3,5-dimethyl-1H-indol-2-yl)methyl]-1-oxa-9-azaspiro[5.5]undecane-4,5-diol (PubChem CID 164695383) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (4S,5S)-9-[(3,5-dimethyl-1H-indol-2-yl)methyl]-1-oxa-9-azaspiro[5.5]undecane-4,5-diol.
| Compound Name | (4S,5S)-9-[(3,5-dimethyl-1H-indol-2-yl)methyl]-1-oxa-9-azaspiro[5.5]undecane-4,5-diol |
|---|---|
| PubChem CID | 164695383 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (4S,5S)-9-[(3,5-dimethyl-1H-indol-2-yl)methyl]-1-oxa-9-azaspiro[5.5]undecane-4,5-diol |
| SMILES | Cc1ccc2[nH]c(CN3CCC4(CC3)OCC[C@H](O)[C@@H]4O)c(C)c2c1 |
| InChI | InChI=1S/C20H28N2O3/c1-13-3-4-16-15(11-13)14(2)17(21-16)12-22-8-6-20(7-9-22)19(24)18(23)5-10-25-20/h3-4,11,18-19,21,23-24H,5-10,12H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | CNFPAMHBAFIGLF-OALUTQOASA-N |
| XLogP | 2.26 |
| TPSA | 68.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|