C41H30IrN2OP — CID 164702160
3-diphenylphosphoryl-2H-naphthalen-2-ide;iridium(3+);1-phenyl-3-phenyl-2H-benzimidazol-2-ide (PubChem CID 164702160) has the molecular formula C41H30IrN2OP and a molecular weight of 789.90 g/mol. Its IUPAC name is 3-diphenylphosphoryl-2H-naphthalen-2-ide;iridium(3+);1-phenyl-3-phenyl-2H-benzimidazol-2-ide.
| Compound Name | 3-diphenylphosphoryl-2H-naphthalen-2-ide;iridium(3+);1-phenyl-3-phenyl-2H-benzimidazol-2-ide |
|---|---|
| PubChem CID | 164702160 |
| Molecular Formula | C41H30IrN2OP |
| Molecular Weight | 789.90 g/mol |
| Exact Mass | 790.17 |
| IUPAC Name | 3-diphenylphosphoryl-2H-naphthalen-2-ide;iridium(3+);1-phenyl-3-phenyl-2H-benzimidazol-2-ide |
| SMILES | O=P(c1[c-]cc2ccccc2c1)(c1ccccc1)c1ccccc1.[Ir+3].[c-]1ccccc1N1[CH-]N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H16OP.C19H14N2.Ir/c23-24(20-11-3-1-4-12-20,21-13-5-2-6-14-21)22-16-15-18-9-7-8-10-19(18)17-22;1-3-9-16(10-4-1)20-15-21(17-11-5-2-6-12-17)19-14-8-7-13-18(19)20;/h1-15,17H;1-11,13-15H;/q-1;-2;+3 |
| InChIKey | UVPOXFAMDZUKLR-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.90 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|