C25H29N — CID 164706117
CID 164706117 (PubChem CID 164706117) has the molecular formula C25H29N and a molecular weight of 343.51 g/mol.
| Compound Name | CID 164706117 |
|---|---|
| PubChem CID | 164706117 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(cc1C13[C]N(C)C(C)(CC1)CC3)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C25H29N/c1-17-14-19-18-8-6-7-9-20(18)23(2,3)22(19)15-21(17)25-12-10-24(4,11-13-25)26(5)16-25/h6-9,14-15H,10-13H2,1-5H3 |
| InChIKey | KTXNVHXUIXJUCC-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |