C21H20N4 — CID 164709474
(4S)-4,5-dimethyl-3-(2-methylphenyl)-3,5,11,14-tetrazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2(6),7,10,12,15-hexaene (PubChem CID 164709474) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is (4S)-4,5-dimethyl-3-(2-methylphenyl)-3,5,11,14-tetrazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2(6),7,10,12,15-hexaene.
| Compound Name | (4S)-4,5-dimethyl-3-(2-methylphenyl)-3,5,11,14-tetrazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2(6),7,10,12,15-hexaene |
|---|---|
| PubChem CID | 164709474 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (4S)-4,5-dimethyl-3-(2-methylphenyl)-3,5,11,14-tetrazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2(6),7,10,12,15-hexaene |
| SMILES | Cc1ccccc1N1c2c(ccc3c2ccn2ccnc32)N(C)[C@@H]1C |
| InChI | InChI=1S/C21H20N4/c1-14-6-4-5-7-18(14)25-15(2)23(3)19-9-8-17-16(20(19)25)10-12-24-13-11-22-21(17)24/h4-13,15H,1-3H3/t15-/m0/s1 |
| InChIKey | NZKYSAYRWTUDMH-HNNXBMFYSA-N |
| XLogP | 4.73 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |