C21H35FO2 — CID 164710655
1-tert-butyl-4-[4-(4,4-dimethylpentoxy)butoxy]-2-fluorobenzene (PubChem CID 164710655) has the molecular formula C21H35FO2 and a molecular weight of 338.51 g/mol. Its IUPAC name is 1-tert-butyl-4-[4-(4,4-dimethylpentoxy)butoxy]-2-fluorobenzene.
| Compound Name | 1-tert-butyl-4-[4-(4,4-dimethylpentoxy)butoxy]-2-fluorobenzene |
|---|---|
| PubChem CID | 164710655 |
| Molecular Formula | C21H35FO2 |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 1-tert-butyl-4-[4-(4,4-dimethylpentoxy)butoxy]-2-fluorobenzene |
| SMILES | CC(C)(C)CCCOCCCCOc1ccc(C(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C21H35FO2/c1-20(2,3)12-9-14-23-13-7-8-15-24-17-10-11-18(19(22)16-17)21(4,5)6/h10-11,16H,7-9,12-15H2,1-6H3 |
| InChIKey | IGISTTWCOZDDRO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|