C22H28FNO3 — CID 164724761
[3-(hydroxymethyl)-2-methoxyphenyl]-[2,2,3,3,4,5,5,6,6-nonadeuterio-1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]methanol (PubChem CID 164724761) has the molecular formula C22H28FNO3 and a molecular weight of 382.52 g/mol. Its IUPAC name is [3-(hydroxymethyl)-2-methoxyphenyl]-[2,2,3,3,4,5,5,6,6-nonadeuterio-1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]methanol.
| Compound Name | [3-(hydroxymethyl)-2-methoxyphenyl]-[2,2,3,3,4,5,5,6,6-nonadeuterio-1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 164724761 |
| Molecular Formula | C22H28FNO3 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | [3-(hydroxymethyl)-2-methoxyphenyl]-[2,2,3,3,4,5,5,6,6-nonadeuterio-1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]methanol |
| SMILES | [2H]C1([2H])N(CCc2ccc(F)cc2)C([2H])([2H])C([2H])([2H])C([2H])(C(O)c2cccc(CO)c2OC)C1([2H])[2H] |
| InChI | InChI=1S/C22H28FNO3/c1-27-22-18(15-25)3-2-4-20(22)21(26)17-10-13-24(14-11-17)12-9-16-5-7-19(23)8-6-16/h2-8,17,21,25-26H,9-15H2,1H3/i10D2,11D2,13D2,14D2,17D |
| InChIKey | CAYQFJHIWLCNAS-OFXHMDDBSA-N |
| XLogP | 3.31 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |