C41H48IrNO2- — CID 164727558
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4,5-dimethyl-2-spiro[1,3-dihydroindene-2,2'-3,7-dihydro-1H-cyclopenta[a]naphthalen-7-ide]-8'-ylpyridine;iridium (PubChem CID 164727558) has the molecular formula C41H48IrNO2- and a molecular weight of 779.06 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4,5-dimethyl-2-spiro[1,3-dihydroindene-2,2'-3,7-dihydro-1H-cyclopenta[a]naphthalen-7-ide]-8'-ylpyridine;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4,5-dimethyl-2-spiro[1,3-dihydroindene-2,2'-3,7-dihydro-1H-cyclopenta[a]naphthalen-7-ide]-8'-ylpyridine;iridium |
|---|---|
| PubChem CID | 164727558 |
| Molecular Formula | C41H48IrNO2- |
| Molecular Weight | 779.06 g/mol |
| Exact Mass | 779.33 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4,5-dimethyl-2-spiro[1,3-dihydroindene-2,2'-3,7-dihydro-1H-cyclopenta[a]naphthalen-7-ide]-8'-ylpyridine;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cnc(-c2[c-]cc3ccc4c(c3c2)CC2(Cc3ccccc3C2)C4)cc1C.[Ir] |
| InChI | InChI=1S/C28H24N.C13H24O2.Ir/c1-18-11-27(29-17-19(18)2)21-9-7-20-8-10-24-15-28(16-26(24)25(20)12-21)13-22-5-3-4-6-23(22)14-28;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-8,10-12,17H,13-16H2,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | INZCQUHJIAKEKG-DZTQYQPZSA-N |
| XLogP | 10.07 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.06 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|