C16H27B — CID 164728046
ditert-butyl-(2,6-dimethylphenyl)borane (PubChem CID 164728046) has the molecular formula C16H27B and a molecular weight of 230.20 g/mol. Its IUPAC name is ditert-butyl-(2,6-dimethylphenyl)borane.
| Compound Name | ditert-butyl-(2,6-dimethylphenyl)borane |
|---|---|
| PubChem CID | 164728046 |
| Molecular Formula | C16H27B |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | ditert-butyl-(2,6-dimethylphenyl)borane |
| SMILES | Cc1cccc(C)c1B(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H27B/c1-12-10-9-11-13(2)14(12)17(15(3,4)5)16(6,7)8/h9-11H,1-8H3 |
| InChIKey | NZFKCSNSWAWABB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|