C29H18F5O4S+ — CID 164746645
(9-oxoxanthen-2-yl)-[2-(2,2,3,3,3-pentafluoropropoxycarbonyl)phenyl]-phenylsulfanium (PubChem CID 164746645) has the molecular formula C29H18F5O4S+ and a molecular weight of 557.52 g/mol. Its IUPAC name is (9-oxoxanthen-2-yl)-[2-(2,2,3,3,3-pentafluoropropoxycarbonyl)phenyl]-phenylsulfanium.
| Compound Name | (9-oxoxanthen-2-yl)-[2-(2,2,3,3,3-pentafluoropropoxycarbonyl)phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 164746645 |
| Molecular Formula | C29H18F5O4S+ |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | (9-oxoxanthen-2-yl)-[2-(2,2,3,3,3-pentafluoropropoxycarbonyl)phenyl]-phenylsulfanium |
| SMILES | O=C(OCC(F)(F)C(F)(F)F)c1ccccc1[S+](c1ccccc1)c1ccc2oc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C29H18F5O4S/c30-28(31,29(32,33)34)17-37-27(36)21-11-5-7-13-25(21)39(18-8-2-1-3-9-18)19-14-15-24-22(16-19)26(35)20-10-4-6-12-23(20)38-24/h1-16H,17H2/q+1 |
| InChIKey | BXAVLOSZHIINCI-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|