C22H29N2O2+ — CID 164755803
(2S,3S)-3-ethyl-8-methoxy-2-[(Z)-1-methoxyprop-1-en-2-yl]-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-5-ium (PubChem CID 164755803) has the molecular formula C22H29N2O2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is (2S,3S)-3-ethyl-8-methoxy-2-[(Z)-1-methoxyprop-1-en-2-yl]-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-5-ium.
| Compound Name | (2S,3S)-3-ethyl-8-methoxy-2-[(Z)-1-methoxyprop-1-en-2-yl]-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 164755803 |
| Molecular Formula | C22H29N2O2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (2S,3S)-3-ethyl-8-methoxy-2-[(Z)-1-methoxyprop-1-en-2-yl]-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-5-ium |
| SMILES | CC[C@@H]1C[N+]2=C(C[C@@H]1/C(C)=C\OC)c1[nH]c3cccc(OC)c3c1CC2 |
| InChI | InChI=1S/C22H28N2O2/c1-5-15-12-24-10-9-16-21-18(7-6-8-20(21)26-4)23-22(16)19(24)11-17(15)14(2)13-25-3/h6-8,13,15,17H,5,9-12H2,1-4H3/p+1/b14-13-/t15-,17-/m1/s1 |
| InChIKey | SXEVQTNRRZRDRD-XQJAURSCSA-O |
| XLogP | 4.13 |
| TPSA | 37.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|