C40H30N2O4S2 — CID 164759512
CID 164759512 (PubChem CID 164759512) has the molecular formula C40H30N2O4S2 and a molecular weight of 666.82 g/mol.
| Compound Name | CID 164759512 |
|---|---|
| PubChem CID | 164759512 |
| Molecular Formula | C40H30N2O4S2 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | — |
| SMILES | O=c1c(=NC2=Cc3sc4c(c3C23CCCCC3)C2(CCCCC2)c2cc(N=c3c(=O)c5ccccc5c3=O)sc2-4)c(=O)c2ccccc12 |
| InChI | InChI=1S/C40H30N2O4S2/c43-33-21-11-3-4-12-22(21)34(44)31(33)41-27-20-26-29(40(27)17-9-2-10-18-40)30-38(47-26)37-25(39(30)15-7-1-8-16-39)19-28(48-37)42-32-35(45)23-13-5-6-14-24(23)36(32)46/h3-6,11-14,19-20H,1-2,7-10,15-18H2 |
| InChIKey | DTBXJHGKHFNFEL-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |