About CID 164759642
CID 164759642 (PubChem CID 164759642) has the molecular formula C56H44N2O4S2
and a molecular weight of 873.11 g/mol.
Molecular Properties
| Compound Name | CID 164759642 |
| PubChem CID | 164759642 |
| Molecular Formula | C56H44N2O4S2 |
| Molecular Weight | 873.11 g/mol |
| Exact Mass | 872.27 |
| IUPAC Name | — |
| SMILES | O=c1c(=NC2=Cc3sc4c(c3C23CCCCC3)C2(CCCCC2)c2c-4sc3c2C2(CCCCC2)C(N=c2c(=O)c4cc5ccccc5cc4c2=O)=C3)c(=O)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C56H44N2O4S2/c59-48-34-24-30-14-4-5-15-31(30)25-35(34)49(60)46(48)57-40-28-38-42(54(40)18-8-1-9-19-54)44-52(63-38)53-45(56(44)22-12-3-13-23-56)43-39(64-53)29-41(55(43)20-10-2-11-21-55)58-47-50(61)36-26-32-16-6-7-17-33(32)27-37(36)51(47)62/h4-7,14-17,24-29H,1-3,8-13,18-23H2 |
| InChIKey | XCKCOXARNSWBDH-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 873.11 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 164759642 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164759642?
The IUPAC name of CID 164759642 (CID 164759642) is not available.
What is the SMILES notation for CID 164759642?
The canonical SMILES for CID 164759642 is O=c1c(=NC2=Cc3sc4c(c3C23CCCCC3)C2(CCCCC2)c2c-4sc3c2C2(CCCCC2)C(N=c2c(=O)c4cc5ccccc5cc4c2=O)=C3)c(=O)c2cc3ccccc3cc12.
What is the InChIKey of CID 164759642?
The InChIKey is XCKCOXARNSWBDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C56H44N2O4S2/c59-48-34-24-30-14-4-5-15-31(30)25-35(34)49(60)46(48)57-40-28-38-42(54(40)18-8-1-9-19-54)44-52(63-38)53-45(56(44)22-12-3-13-23-56)43-39(64-53)29-41(55(43)20-10-2-11-21-55)58-47-50(61)36-26-32-16-6-7-17-33(32)27-37(36)51(47)62/h4-7,14-17,24-29H,1-3,8-13,18-23H2.
What are the key properties of CID 164759642?
CID 164759642 has a molecular weight of 873.11 g/mol, XLogP of 11.16, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164759642 is sourced from PubChem (CID 164759642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).