C42H30N2O4S3 — CID 164759220
CID 164759220 (PubChem CID 164759220) has the molecular formula C42H30N2O4S3 and a molecular weight of 722.91 g/mol.
| Compound Name | CID 164759220 |
|---|---|
| PubChem CID | 164759220 |
| Molecular Formula | C42H30N2O4S3 |
| Molecular Weight | 722.91 g/mol |
| Exact Mass | 722.14 |
| IUPAC Name | — |
| SMILES | O=c1c(=NC2=Cc3sc4c(sc5c6c(sc54)C=C(N=c4c(=O)c5ccccc5c4=O)C64CCCCC4)c3C23CCCCC3)c(=O)c2ccccc12 |
| InChI | InChI=1S/C42H30N2O4S3/c45-33-21-11-3-4-12-22(21)34(46)31(33)43-27-19-25-29(41(27)15-7-1-8-16-41)37-39(49-25)40-38(51-37)30-26(50-40)20-28(42(30)17-9-2-10-18-42)44-32-35(47)23-13-5-6-14-24(23)36(32)48/h3-6,11-14,19-20H,1-2,7-10,15-18H2 |
| InChIKey | HFZTYEZSQCCNEX-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.91 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |