C26H50 — CID 164773488
(6Z,15Z)-11-(2,2-dimethylpropyl)henicosa-6,15-diene (PubChem CID 164773488) has the molecular formula C26H50 and a molecular weight of 362.69 g/mol. Its IUPAC name is (6Z,15Z)-11-(2,2-dimethylpropyl)henicosa-6,15-diene.
| Compound Name | (6Z,15Z)-11-(2,2-dimethylpropyl)henicosa-6,15-diene |
|---|---|
| PubChem CID | 164773488 |
| Molecular Formula | C26H50 |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 362.39 |
| IUPAC Name | (6Z,15Z)-11-(2,2-dimethylpropyl)henicosa-6,15-diene |
| SMILES | CCCCC/C=C\CCCC(CCC/C=C\CCCCC)CC(C)(C)C |
| InChI | InChI=1S/C26H50/c1-6-8-10-12-14-16-18-20-22-25(24-26(3,4)5)23-21-19-17-15-13-11-9-7-2/h14-17,25H,6-13,18-24H2,1-5H3/b16-14-,17-15- |
| InChIKey | MVAAIGPENANKSN-RYOQUFEFSA-N |
| XLogP | 9.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|