C23H24N6O2S — CID 164791285
3-[(3R,4R)-3-[[1-(benzenesulfonyl)-5-isocyanopyrrolo[2,3-b]pyridin-4-yl]amino]-4-ethylpyrrolidin-1-yl]propanenitrile (PubChem CID 164791285) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is 3-[(3R,4R)-3-[[1-(benzenesulfonyl)-5-isocyanopyrrolo[2,3-b]pyridin-4-yl]amino]-4-ethylpyrrolidin-1-yl]propanenitrile.
| Compound Name | 3-[(3R,4R)-3-[[1-(benzenesulfonyl)-5-isocyanopyrrolo[2,3-b]pyridin-4-yl]amino]-4-ethylpyrrolidin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 164791285 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-[(3R,4R)-3-[[1-(benzenesulfonyl)-5-isocyanopyrrolo[2,3-b]pyridin-4-yl]amino]-4-ethylpyrrolidin-1-yl]propanenitrile |
| SMILES | [C-]#[N+]c1cnc2c(ccn2S(=O)(=O)c2ccccc2)c1N[C@H]1CN(CCC#N)C[C@H]1CC |
| InChI | InChI=1S/C23H24N6O2S/c1-3-17-15-28(12-7-11-24)16-21(17)27-22-19-10-13-29(23(19)26-14-20(22)25-2)32(30,31)18-8-5-4-6-9-18/h4-6,8-10,13-14,17,21H,3,7,12,15-16H2,1H3,(H,26,27)/t17-,21+/m1/s1 |
| InChIKey | OPEABMUQOKOEAJ-UTKZUKDTSA-N |
| XLogP | 3.86 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|