C28H38O7 — CID 164793546
1-O-(2-hydroxy-3-phenoxypropyl) 5-O-(2-methoxyethyl) 2-methyl-4-(2-phenylbutyl)pentanedioate (PubChem CID 164793546) has the molecular formula C28H38O7 and a molecular weight of 486.61 g/mol. Its IUPAC name is 1-O-(2-hydroxy-3-phenoxypropyl) 5-O-(2-methoxyethyl) 2-methyl-4-(2-phenylbutyl)pentanedioate.
| Compound Name | 1-O-(2-hydroxy-3-phenoxypropyl) 5-O-(2-methoxyethyl) 2-methyl-4-(2-phenylbutyl)pentanedioate |
|---|---|
| PubChem CID | 164793546 |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 1-O-(2-hydroxy-3-phenoxypropyl) 5-O-(2-methoxyethyl) 2-methyl-4-(2-phenylbutyl)pentanedioate |
| SMILES | CCC(CC(CC(C)C(=O)OCC(O)COc1ccccc1)C(=O)OCCOC)c1ccccc1 |
| InChI | InChI=1S/C28H38O7/c1-4-22(23-11-7-5-8-12-23)18-24(28(31)33-16-15-32-3)17-21(2)27(30)35-20-25(29)19-34-26-13-9-6-10-14-26/h5-14,21-22,24-25,29H,4,15-20H2,1-3H3 |
| InChIKey | PEEANJOUNNDGJU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|