C18H27NO — CID 164799608
(1R,2S,4S)-2-[3-(methylamino)cyclohexyl]-4-phenylcyclopentan-1-ol (PubChem CID 164799608) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (1R,2S,4S)-2-[3-(methylamino)cyclohexyl]-4-phenylcyclopentan-1-ol.
| Compound Name | (1R,2S,4S)-2-[3-(methylamino)cyclohexyl]-4-phenylcyclopentan-1-ol |
|---|---|
| PubChem CID | 164799608 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (1R,2S,4S)-2-[3-(methylamino)cyclohexyl]-4-phenylcyclopentan-1-ol |
| SMILES | CNC1CCCC([C@@H]2C[C@H](c3ccccc3)C[C@H]2O)C1 |
| InChI | InChI=1S/C18H27NO/c1-19-16-9-5-8-14(10-16)17-11-15(12-18(17)20)13-6-3-2-4-7-13/h2-4,6-7,14-20H,5,8-12H2,1H3/t14?,15-,16?,17-,18+/m0/s1 |
| InChIKey | WSYFIYAINVUEKM-YVZBVZGPSA-N |
| XLogP | 3.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |