C60H40IrN5 — CID 164805127
CID 164805127 (PubChem CID 164805127) has the molecular formula C60H40IrN5 and a molecular weight of 1023.23 g/mol.
| Compound Name | CID 164805127 |
|---|---|
| PubChem CID | 164805127 |
| Molecular Formula | C60H40IrN5 |
| Molecular Weight | 1023.23 g/mol |
| Exact Mass | 1023.29 |
| IUPAC Name | — |
| SMILES | [Ir+3].[c-]1ccccc1-c1ccc(CCc2cc(CCc3ccc(-c4[c-]cccc4)nc3)cc(-c3ccccc3-c3cnc4c5[c-]cccc5n5c6cc7ccccc7cc6nc5c4c3)c2)cn1 |
| InChI | InChI=1S/C60H40N5.Ir/c1-3-13-44(14-4-1)54-29-27-40(37-61-54)23-25-42-31-43(26-24-41-28-30-55(62-38-41)45-15-5-2-6-16-45)33-48(32-42)50-19-9-10-20-51(50)49-34-53-59(63-39-49)52-21-11-12-22-57(52)65-58-36-47-18-8-7-17-46(47)35-56(58)64-60(53)65;/h1-13,15,17-20,22,27-39H,23-26H2;/q-3;+3 |
| InChIKey | YOQHYOVFABJZPW-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.23 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|