C64H42IrN5 — CID 164805119
CID 164805119 (PubChem CID 164805119) has the molecular formula C64H42IrN5 and a molecular weight of 1081.34 g/mol.
| Compound Name | CID 164805119 |
|---|---|
| PubChem CID | 164805119 |
| Molecular Formula | C64H42IrN5 |
| Molecular Weight | 1081.34 g/mol |
| Exact Mass | 1081.36 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1ccc(-c2[c-]cccc2)nc1)C([2H])([2H])c1cc(-c2ccccc2-c2cnc3c4[c-]cccc4c4cnc5c6cc(-c7ccccc7)ccc6c2c3n45)cc(C([2H])([2H])C([2H])([2H])c2ccc(-c3[c-]cccc3)nc2)c1.[Ir+3] |
| InChI | InChI=1S/C64H42N5.Ir/c1-4-14-46(15-5-1)49-30-31-54-56(37-49)64-68-41-60-53-22-12-13-23-55(53)62-63(69(60)64)61(54)57(40-67-62)52-21-11-10-20-51(52)50-35-44(26-24-42-28-32-58(65-38-42)47-16-6-2-7-17-47)34-45(36-50)27-25-43-29-33-59(66-39-43)48-18-8-3-9-19-48;/h1-16,18,20-22,28-41H,24-27H2;/q-3;+3/i24D2,25D2,26D2,27D2; |
| InChIKey | OTGKCDGYPGYOJO-FZZROVCOSA-N |
| XLogP | 14.87 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.34 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|