C58H41IrN4 — CID 164805432
CID 164805432 (PubChem CID 164805432) has the molecular formula C58H41IrN4 and a molecular weight of 994.26 g/mol.
| Compound Name | CID 164805432 |
|---|---|
| PubChem CID | 164805432 |
| Molecular Formula | C58H41IrN4 |
| Molecular Weight | 994.26 g/mol |
| Exact Mass | 994.35 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1ccc(-c2[c-]cccc2)nc1)C([2H])([2H])c1cc(-c2ccccc2-c2cnc3c4[c-]cccc4n4c5ccccc5c(C)c4c3c2)cc(C([2H])([2H])C([2H])([2H])c2ccc(-c3[c-]cccc3)nc2)c1.[Ir+3] |
| InChI | InChI=1S/C58H41N4.Ir/c1-39-48-18-10-12-22-55(48)62-56-23-13-11-21-51(56)57-52(58(39)62)35-47(38-61-57)50-20-9-8-19-49(50)46-33-42(26-24-40-28-30-53(59-36-40)44-14-4-2-5-15-44)32-43(34-46)27-25-41-29-31-54(60-37-41)45-16-6-3-7-17-45;/h2-14,16,18-20,22-23,28-38H,24-27H2,1H3;/q-3;+3/i24D2,25D2,26D2,27D2; |
| InChIKey | OXIPMLFDOFDJKT-FZZROVCOSA-N |
| XLogP | 13.53 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.26 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|