C73H56IrN7 — CID 164805325
CID 164805325 (PubChem CID 164805325) has the molecular formula C73H56IrN7 and a molecular weight of 1237.60 g/mol.
| Compound Name | CID 164805325 |
|---|---|
| PubChem CID | 164805325 |
| Molecular Formula | C73H56IrN7 |
| Molecular Weight | 1237.60 g/mol |
| Exact Mass | 1237.51 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c(C([2H])([2H])C([2H])([2H])c2cc(-c3ccccc3-c3cnc(-c4[c-]cccc4)cc3-c3ccc(-c4ccccc4)cc3)cc(C([2H])([2H])C([2H])([2H])c3cnc4c5[c-]cccc5n5c(C)c(C)nc5c4c3C([2H])([2H])[2H])c2)cnc2c3[c-]cccc3n3c(C)c(C)nc3c12.[Ir+3] |
| InChI | InChI=1S/C73H56N7.Ir/c1-44-56(41-75-70-61-25-15-17-27-66(61)79-48(5)46(3)77-72(79)68(44)70)31-29-50-37-51(30-32-57-42-76-71-62-26-16-18-28-67(62)80-49(6)47(4)78-73(80)69(71)45(57)2)39-58(38-50)59-23-13-14-24-60(59)64-43-74-65(55-21-11-8-12-22-55)40-63(64)54-35-33-53(34-36-54)52-19-9-7-10-20-52;/h7-21,23-24,27-28,33-43H,29-32H2,1-6H3;/q-3;+3/i1D3,2D3,29D2,30D2,31D2,32D2; |
| InChIKey | SLXZPWNFKQAJKX-CMDLTZMPSA-N |
| XLogP | 16.93 |
| TPSA | 73.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1237.60 |
| LogP ≤ 5 | 16.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|