C15H18F3N3O7S — CID 164811621
7-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-2,7-dicarboxylate (PubChem CID 164811621) has the molecular formula C15H18F3N3O7S and a molecular weight of 441.38 g/mol. Its IUPAC name is 7-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-2,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-2,7-dicarboxylate |
|---|---|
| PubChem CID | 164811621 |
| Molecular Formula | C15H18F3N3O7S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 7-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-2,7-dicarboxylate |
| SMILES | COC(=O)c1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C15H18F3N3O7S/c1-14(2,3)27-13(23)21-6-5-8-9(7-21)19-10(12(22)26-4)20-11(8)28-29(24,25)15(16,17)18/h5-7H2,1-4H3 |
| InChIKey | QWMKUUNZWFEZDL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 124.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|