C17H24F3N3O5S — CID 86762197
tert-butyl 2-tert-butyl-4-(trifluoromethylsulfonyloxy)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (PubChem CID 86762197) has the molecular formula C17H24F3N3O5S and a molecular weight of 439.46 g/mol. Its IUPAC name is tert-butyl 2-tert-butyl-4-(trifluoromethylsulfonyloxy)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate.
| Compound Name | tert-butyl 2-tert-butyl-4-(trifluoromethylsulfonyloxy)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 86762197 |
| Molecular Formula | C17H24F3N3O5S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | tert-butyl 2-tert-butyl-4-(trifluoromethylsulfonyloxy)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nc(C(C)(C)C)nc(OS(=O)(=O)C(F)(F)F)c2C1 |
| InChI | InChI=1S/C17H24F3N3O5S/c1-15(2,3)13-21-11-7-8-23(14(24)27-16(4,5)6)9-10(11)12(22-13)28-29(25,26)17(18,19)20/h7-9H2,1-6H3 |
| InChIKey | UUDWSBOPHCJPTL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|