C13H16F3N3O5S — CID 134279673
2-tert-butyl-4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid (PubChem CID 134279673) has the molecular formula C13H16F3N3O5S and a molecular weight of 383.35 g/mol. Its IUPAC name is 2-tert-butyl-4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid.
| Compound Name | 2-tert-butyl-4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid |
|---|---|
| PubChem CID | 134279673 |
| Molecular Formula | C13H16F3N3O5S |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-tert-butyl-4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid |
| SMILES | CC(C)(C)c1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCN(C(=O)O)C2 |
| InChI | InChI=1S/C13H16F3N3O5S/c1-12(2,3)10-17-8-6-19(11(20)21)5-4-7(8)9(18-10)24-25(22,23)13(14,15)16/h4-6H2,1-3H3,(H,20,21) |
| InChIKey | FMKMTJXUOORMPI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|