C13H18F3N3O3S2 — CID 175082891
[7-(2-methylpropyl)-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl] trifluoromethanesulfonate (PubChem CID 175082891) has the molecular formula C13H18F3N3O3S2 and a molecular weight of 385.43 g/mol. Its IUPAC name is [7-(2-methylpropyl)-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl] trifluoromethanesulfonate.
| Compound Name | [7-(2-methylpropyl)-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175082891 |
| Molecular Formula | C13H18F3N3O3S2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | [7-(2-methylpropyl)-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl] trifluoromethanesulfonate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCN(CC(C)C)C2 |
| InChI | InChI=1S/C13H18F3N3O3S2/c1-8(2)6-19-5-4-9-10(7-19)17-12(23-3)18-11(9)22-24(20,21)13(14,15)16/h8H,4-7H2,1-3H3 |
| InChIKey | GPLFILSUQDMZES-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|