C15H20F3N3O3S2 — CID 162482576
(7-cyclohexyl-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate (PubChem CID 162482576) has the molecular formula C15H20F3N3O3S2 and a molecular weight of 411.47 g/mol. Its IUPAC name is (7-cyclohexyl-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate.
| Compound Name | (7-cyclohexyl-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162482576 |
| Molecular Formula | C15H20F3N3O3S2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (7-cyclohexyl-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCN(C1CCCCC1)C2 |
| InChI | InChI=1S/C15H20F3N3O3S2/c1-25-14-19-12-9-21(10-5-3-2-4-6-10)8-7-11(12)13(20-14)24-26(22,23)15(16,17)18/h10H,2-9H2,1H3 |
| InChIKey | GGJMORSYJXRLIM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|