C10H12F3N3O3S2 — CID 170111192
(7-methyl-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate (PubChem CID 170111192) has the molecular formula C10H12F3N3O3S2 and a molecular weight of 343.35 g/mol. Its IUPAC name is (7-methyl-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate.
| Compound Name | (7-methyl-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 170111192 |
| Molecular Formula | C10H12F3N3O3S2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | (7-methyl-2-methylsulfanyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl) trifluoromethanesulfonate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCN(C)C2 |
| InChI | InChI=1S/C10H12F3N3O3S2/c1-16-4-3-6-7(5-16)14-9(20-2)15-8(6)19-21(17,18)10(11,12)13/h3-5H2,1-2H3 |
| InChIKey | LQAPDLWDRNHIKG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|