C18H21N3O3S2 — CID 164821400
(4R)-4-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-6-yl]pentane-2-sulfinamide (PubChem CID 164821400) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is (4R)-4-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-6-yl]pentane-2-sulfinamide.
| Compound Name | (4R)-4-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-6-yl]pentane-2-sulfinamide |
|---|---|
| PubChem CID | 164821400 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (4R)-4-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-6-yl]pentane-2-sulfinamide |
| SMILES | CC(C[C@@H](C)c1ccc2ccn(S(=O)(=O)c3ccccc3)c2n1)S(N)=O |
| InChI | InChI=1S/C18H21N3O3S2/c1-13(12-14(2)25(19)22)17-9-8-15-10-11-21(18(15)20-17)26(23,24)16-6-4-3-5-7-16/h3-11,13-14H,12,19H2,1-2H3/t13-,14?,25?/m1/s1 |
| InChIKey | LPVOEVZSSCBVMS-GCKASKAXSA-N |
| XLogP | 2.78 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |