C49H61N3O9S — CID 164822082
[2-[C-(1,3-benzothiazol-2-yl)-N-[(8-ethoxy-8-oxooctyl)amino]carbonimidoyl]-4-(4-ethylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 164822082) has the molecular formula C49H61N3O9S and a molecular weight of 868.11 g/mol. Its IUPAC name is [2-[C-(1,3-benzothiazol-2-yl)-N-[(8-ethoxy-8-oxooctyl)amino]carbonimidoyl]-4-(4-ethylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [2-[C-(1,3-benzothiazol-2-yl)-N-[(8-ethoxy-8-oxooctyl)amino]carbonimidoyl]-4-(4-ethylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 164822082 |
| Molecular Formula | C49H61N3O9S |
| Molecular Weight | 868.11 g/mol |
| Exact Mass | 867.41 |
| IUPAC Name | [2-[C-(1,3-benzothiazol-2-yl)-N-[(8-ethoxy-8-oxooctyl)amino]carbonimidoyl]-4-(4-ethylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C3CCC(CC)CC3)cc2C(=NNCCCCCCCC(=O)OCC)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C49H61N3O9S/c1-4-35-21-23-36(24-22-35)48(55)60-39-29-30-42(61-49(56)37-25-27-38(28-26-37)58-32-16-10-11-17-33-59-44(53)5-2)40(34-39)46(47-51-41-18-13-14-19-43(41)62-47)52-50-31-15-9-7-8-12-20-45(54)57-6-3/h5,13-14,18-19,25-30,34-36,50H,2,4,6-12,15-17,20-24,31-33H2,1,3H3 |
| InChIKey | CFINLGOEZPWAOT-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 151.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.11 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|