C40H45N3O8S — CID 175197786
[4-(4-ethylcyclohexanecarbonyl)oxy-2-[C-(6-methoxy-1,3-benzothiazol-2-yl)carbonohydrazonoyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 175197786) has the molecular formula C40H45N3O8S and a molecular weight of 727.88 g/mol. Its IUPAC name is [4-(4-ethylcyclohexanecarbonyl)oxy-2-[C-(6-methoxy-1,3-benzothiazol-2-yl)carbonohydrazonoyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-(4-ethylcyclohexanecarbonyl)oxy-2-[C-(6-methoxy-1,3-benzothiazol-2-yl)carbonohydrazonoyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 175197786 |
| Molecular Formula | C40H45N3O8S |
| Molecular Weight | 727.88 g/mol |
| Exact Mass | 727.29 |
| IUPAC Name | [4-(4-ethylcyclohexanecarbonyl)oxy-2-[C-(6-methoxy-1,3-benzothiazol-2-yl)carbonohydrazonoyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C3CCC(CC)CC3)cc2C(=NN)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C40H45N3O8S/c1-4-26-10-12-27(13-11-26)39(45)50-31-19-21-34(32(24-31)37(43-41)38-42-33-20-18-30(47-3)25-35(33)52-38)51-40(46)28-14-16-29(17-15-28)48-22-8-6-7-9-23-49-36(44)5-2/h5,14-21,24-27H,2,4,6-13,22-23,41H2,1,3H3 |
| InChIKey | CUVDYLPLJZTISL-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.88 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|