C48H61N3O7S — CID 164822071
[4-(4-butylcyclohexanecarbonyl)oxy-2-[C-hexyl-N-[(4-methyl-1,3-benzothiazol-2-yl)amino]carbonimidoyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 164822071) has the molecular formula C48H61N3O7S and a molecular weight of 824.10 g/mol. Its IUPAC name is [4-(4-butylcyclohexanecarbonyl)oxy-2-[C-hexyl-N-[(4-methyl-1,3-benzothiazol-2-yl)amino]carbonimidoyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-(4-butylcyclohexanecarbonyl)oxy-2-[C-hexyl-N-[(4-methyl-1,3-benzothiazol-2-yl)amino]carbonimidoyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 164822071 |
| Molecular Formula | C48H61N3O7S |
| Molecular Weight | 824.10 g/mol |
| Exact Mass | 823.42 |
| IUPAC Name | [4-(4-butylcyclohexanecarbonyl)oxy-2-[C-hexyl-N-[(4-methyl-1,3-benzothiazol-2-yl)amino]carbonimidoyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C3CCC(CCCC)CC3)cc2C(CCCCCC)=NNc2nc3c(C)cccc3s2)cc1 |
| InChI | InChI=1S/C48H61N3O7S/c1-5-8-10-13-19-41(50-51-48-49-45-34(4)17-16-20-43(45)59-48)40-33-39(57-46(53)36-23-21-35(22-24-36)18-9-6-2)29-30-42(40)58-47(54)37-25-27-38(28-26-37)55-31-14-11-12-15-32-56-44(52)7-3/h7,16-17,20,25-30,33,35-36H,3,5-6,8-15,18-19,21-24,31-32H2,1-2,4H3,(H,49,51) |
| InChIKey | IXPUJIWFDMFIME-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 125.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.10 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|