C18H19F2N5O — CID 164822686
5-[(2,6-difluoro-4-pyridinyl)amino]-N-pentyl-1H-pyrrolo[2,3-c]pyridine-7-carboxamide (PubChem CID 164822686) has the molecular formula C18H19F2N5O and a molecular weight of 359.38 g/mol. Its IUPAC name is 5-[(2,6-difluoro-4-pyridinyl)amino]-N-pentyl-1H-pyrrolo[2,3-c]pyridine-7-carboxamide.
| Compound Name | 5-[(2,6-difluoro-4-pyridinyl)amino]-N-pentyl-1H-pyrrolo[2,3-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 164822686 |
| Molecular Formula | C18H19F2N5O |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 5-[(2,6-difluoro-4-pyridinyl)amino]-N-pentyl-1H-pyrrolo[2,3-c]pyridine-7-carboxamide |
| SMILES | CCCCCNC(=O)c1nc(Nc2cc(F)nc(F)c2)cc2cc[nH]c12 |
| InChI | InChI=1S/C18H19F2N5O/c1-2-3-4-6-22-18(26)17-16-11(5-7-21-16)8-15(25-17)23-12-9-13(19)24-14(20)10-12/h5,7-10,21H,2-4,6H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | NPMQIQSCMZBCAI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|