C30H54N2 — CID 164855886
(1Z,3E,5Z)-3-ethylidene-5,6-dimethyl-4-methylidene-7-methyliminoocta-1,5-dien-1-amine;1-ethyl-4-methylcyclohexane;2-methylhex-1-ene (PubChem CID 164855886) has the molecular formula C30H54N2 and a molecular weight of 442.78 g/mol. Its IUPAC name is (1Z,3E,5Z)-3-ethylidene-5,6-dimethyl-4-methylidene-7-methyliminoocta-1,5-dien-1-amine;1-ethyl-4-methylcyclohexane;2-methylhex-1-ene.
| Compound Name | (1Z,3E,5Z)-3-ethylidene-5,6-dimethyl-4-methylidene-7-methyliminoocta-1,5-dien-1-amine;1-ethyl-4-methylcyclohexane;2-methylhex-1-ene |
|---|---|
| PubChem CID | 164855886 |
| Molecular Formula | C30H54N2 |
| Molecular Weight | 442.78 g/mol |
| Exact Mass | 442.43 |
| IUPAC Name | (1Z,3E,5Z)-3-ethylidene-5,6-dimethyl-4-methylidene-7-methyliminoocta-1,5-dien-1-amine;1-ethyl-4-methylcyclohexane;2-methylhex-1-ene |
| SMILES | C=C(/C(C)=C(C)\C(C)=N\C)C(/C=C\N)=C/C.C=C(C)CCCC.CCC1CCC(C)CC1 |
| InChI | InChI=1S/C14H22N2.C9H18.C7H14/c1-7-14(8-9-15)12(4)10(2)11(3)13(5)16-6;1-3-9-6-4-8(2)5-7-9;1-4-5-6-7(2)3/h7-9H,4,15H2,1-3,5-6H3;8-9H,3-7H2,1-2H3;2,4-6H2,1,3H3/b9-8-,11-10-,14-7+,16-13+;; |
| InChIKey | BBUFRTQTVUXPBY-PLDQTYTMSA-N |
| XLogP | 9.36 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.78 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|