C23H35FN2O2 — CID 164868367
2-[(E)-2-ethyl-2-methyldec-5-enyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 164868367) has the molecular formula C23H35FN2O2 and a molecular weight of 390.54 g/mol. Its IUPAC name is 2-[(E)-2-ethyl-2-methyldec-5-enyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | 2-[(E)-2-ethyl-2-methyldec-5-enyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 164868367 |
| Molecular Formula | C23H35FN2O2 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 2-[(E)-2-ethyl-2-methyldec-5-enyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | CCCC/C=C/CCC(C)(CC)CN1CCc2cc(C(=O)NO)cc(F)c2C1 |
| InChI | InChI=1S/C23H35FN2O2/c1-4-6-7-8-9-10-12-23(3,5-2)17-26-13-11-18-14-19(22(27)25-28)15-21(24)20(18)16-26/h8-9,14-15,28H,4-7,10-13,16-17H2,1-3H3,(H,25,27)/b9-8+ |
| InChIKey | YXBPQOAHJQGZDN-CMDGGOBGSA-N |
| XLogP | 5.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|