C23H29FN2O3S — CID 164868590
6-fluoro-N-hydroxy-4-methylsulfanyl-2-(oxetan-3-ylmethyl)-1,3,4,5-tetrahydro-2-benzazepine-8-carboxamide;toluene (PubChem CID 164868590) has the molecular formula C23H29FN2O3S and a molecular weight of 432.56 g/mol. Its IUPAC name is 6-fluoro-N-hydroxy-4-methylsulfanyl-2-(oxetan-3-ylmethyl)-1,3,4,5-tetrahydro-2-benzazepine-8-carboxamide;toluene.
| Compound Name | 6-fluoro-N-hydroxy-4-methylsulfanyl-2-(oxetan-3-ylmethyl)-1,3,4,5-tetrahydro-2-benzazepine-8-carboxamide;toluene |
|---|---|
| PubChem CID | 164868590 |
| Molecular Formula | C23H29FN2O3S |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 6-fluoro-N-hydroxy-4-methylsulfanyl-2-(oxetan-3-ylmethyl)-1,3,4,5-tetrahydro-2-benzazepine-8-carboxamide;toluene |
| SMILES | CSC1Cc2c(F)cc(C(=O)NO)cc2CN(CC2COC2)C1.Cc1ccccc1 |
| InChI | InChI=1S/C16H21FN2O3S.C7H8/c1-23-13-4-14-12(2-11(3-15(14)17)16(20)18-21)6-19(7-13)5-10-8-22-9-10;1-7-5-3-2-4-6-7/h2-3,10,13,21H,4-9H2,1H3,(H,18,20);2-6H,1H3 |
| InChIKey | HFYCZWQKFMALPX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|