C25H21Cl2N3OS — CID 164877526
3,4-dichloro-N-[3-[2-(1-methylindol-3-yl)ethoxy]phenyl]sulfanyl-1H-indol-7-amine (PubChem CID 164877526) has the molecular formula C25H21Cl2N3OS and a molecular weight of 482.44 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[2-(1-methylindol-3-yl)ethoxy]phenyl]sulfanyl-1H-indol-7-amine.
| Compound Name | 3,4-dichloro-N-[3-[2-(1-methylindol-3-yl)ethoxy]phenyl]sulfanyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 164877526 |
| Molecular Formula | C25H21Cl2N3OS |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 3,4-dichloro-N-[3-[2-(1-methylindol-3-yl)ethoxy]phenyl]sulfanyl-1H-indol-7-amine |
| SMILES | Cn1cc(CCOc2cccc(SNc3ccc(Cl)c4c(Cl)c[nH]c34)c2)c2ccccc21 |
| InChI | InChI=1S/C25H21Cl2N3OS/c1-30-15-16(19-7-2-3-8-23(19)30)11-12-31-17-5-4-6-18(13-17)32-29-22-10-9-20(26)24-21(27)14-28-25(22)24/h2-10,13-15,28-29H,11-12H2,1H3 |
| InChIKey | BHAOGRIYLBPIJV-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 41.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|