C16H16ClFN2O5 — CID 164882176
[4-(2,4-dioxopyrimidin-1-yl)-2-fluoro-2-methoxybutyl] 3-chlorobenzoate (PubChem CID 164882176) has the molecular formula C16H16ClFN2O5 and a molecular weight of 370.76 g/mol. Its IUPAC name is [4-(2,4-dioxopyrimidin-1-yl)-2-fluoro-2-methoxybutyl] 3-chlorobenzoate.
| Compound Name | [4-(2,4-dioxopyrimidin-1-yl)-2-fluoro-2-methoxybutyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 164882176 |
| Molecular Formula | C16H16ClFN2O5 |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | [4-(2,4-dioxopyrimidin-1-yl)-2-fluoro-2-methoxybutyl] 3-chlorobenzoate |
| SMILES | COC(F)(CCn1ccc(=O)[nH]c1=O)COC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClFN2O5/c1-24-16(18,6-8-20-7-5-13(21)19-15(20)23)10-25-14(22)11-3-2-4-12(17)9-11/h2-5,7,9H,6,8,10H2,1H3,(H,19,21,23) |
| InChIKey | WAFSXRNBTPWDTB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |