C15H20F4N2OS — CID 164884041
N-[3-[(1R)-1-(tert-butylsulfanylamino)ethyl]-2-fluoro-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 164884041) has the molecular formula C15H20F4N2OS and a molecular weight of 352.40 g/mol. Its IUPAC name is N-[3-[(1R)-1-(tert-butylsulfanylamino)ethyl]-2-fluoro-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[3-[(1R)-1-(tert-butylsulfanylamino)ethyl]-2-fluoro-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 164884041 |
| Molecular Formula | C15H20F4N2OS |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[3-[(1R)-1-(tert-butylsulfanylamino)ethyl]-2-fluoro-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(F)(F)F)cc([C@@H](C)NSC(C)(C)C)c1F |
| InChI | InChI=1S/C15H20F4N2OS/c1-8(21-23-14(3,4)5)11-6-10(15(17,18)19)7-12(13(11)16)20-9(2)22/h6-8,21H,1-5H3,(H,20,22)/t8-/m1/s1 |
| InChIKey | UHBKTBNABVCPNG-MRVPVSSYSA-N |
| XLogP | 4.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|