C35H45NO8Si — CID 164889186
methyl (2S)-2-[3-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]propanoylamino]-3-phenylpropanoate (PubChem CID 164889186) has the molecular formula C35H45NO8Si and a molecular weight of 635.83 g/mol. Its IUPAC name is methyl (2S)-2-[3-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]propanoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[3-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]propanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 164889186 |
| Molecular Formula | C35H45NO8Si |
| Molecular Weight | 635.83 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | methyl (2S)-2-[3-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]propanoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)CC[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C35H45NO8Si/c1-35(2,3)45(25-16-10-6-11-17-25,26-18-12-7-13-19-26)43-23-29-32(39)33(40)31(38)28(44-29)20-21-30(37)36-27(34(41)42-4)22-24-14-8-5-9-15-24/h5-19,27-29,31-33,38-40H,20-23H2,1-4H3,(H,36,37)/t27-,28+,29+,31-,32+,33+/m0/s1 |
| InChIKey | LHROCGGZCNVFJM-LOLBOLQGSA-N |
| XLogP | 2.09 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.83 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|