C8H7Cl3O2 — CID 164891467
(2,4,6-trichloro-3-methoxyphenyl)methanol (PubChem CID 164891467) has the molecular formula C8H7Cl3O2 and a molecular weight of 241.50 g/mol. Its IUPAC name is (2,4,6-trichloro-3-methoxyphenyl)methanol.
| Compound Name | (2,4,6-trichloro-3-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 164891467 |
| Molecular Formula | C8H7Cl3O2 |
| Molecular Weight | 241.50 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | (2,4,6-trichloro-3-methoxyphenyl)methanol |
| SMILES | COc1c(Cl)cc(Cl)c(CO)c1Cl |
| InChI | InChI=1S/C8H7Cl3O2/c1-13-8-6(10)2-5(9)4(3-12)7(8)11/h2,12H,3H2,1H3 |
| InChIKey | XQMBHUZJBQDROV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |