C8H10Cl2N2O — CID 23346999
3-(aminomethyl)-2,5-dichloro-4-methoxyaniline (PubChem CID 23346999) has the molecular formula C8H10Cl2N2O and a molecular weight of 221.09 g/mol. Its IUPAC name is 3-(aminomethyl)-2,5-dichloro-4-methoxyaniline.
| Compound Name | 3-(aminomethyl)-2,5-dichloro-4-methoxyaniline |
|---|---|
| PubChem CID | 23346999 |
| Molecular Formula | C8H10Cl2N2O |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 3-(aminomethyl)-2,5-dichloro-4-methoxyaniline |
| SMILES | COc1c(Cl)cc(N)c(Cl)c1CN |
| InChI | InChI=1S/C8H10Cl2N2O/c1-13-8-4(3-11)7(10)6(12)2-5(8)9/h2H,3,11-12H2,1H3 |
| InChIKey | VWYGDYIADJNFGK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|