C16H26 — CID 164901566
1,4,6-trimethyl-7-propan-2-yl-1,2,3,3a,6,8a-hexahydroazulene (PubChem CID 164901566) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 1,4,6-trimethyl-7-propan-2-yl-1,2,3,3a,6,8a-hexahydroazulene.
| Compound Name | 1,4,6-trimethyl-7-propan-2-yl-1,2,3,3a,6,8a-hexahydroazulene |
|---|---|
| PubChem CID | 164901566 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1,4,6-trimethyl-7-propan-2-yl-1,2,3,3a,6,8a-hexahydroazulene |
| SMILES | CC1=CC(C)C(C(C)C)=CC2C(C)CCC12 |
| InChI | InChI=1S/C16H26/c1-10(2)15-9-16-11(3)6-7-14(16)12(4)8-13(15)5/h8-11,13-14,16H,6-7H2,1-5H3 |
| InChIKey | UCATZIFXRVFHGN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|