C6H10KNO4S2 — CID 164901844
potassium 2-(2-hydroxypropanoylamino)-3-sulfidosulfanylpropanoic acid (PubChem CID 164901844) has the molecular formula C6H10KNO4S2 and a molecular weight of 263.38 g/mol. Its IUPAC name is potassium 2-(2-hydroxypropanoylamino)-3-sulfidosulfanylpropanoic acid.
| Compound Name | potassium 2-(2-hydroxypropanoylamino)-3-sulfidosulfanylpropanoic acid |
|---|---|
| PubChem CID | 164901844 |
| Molecular Formula | C6H10KNO4S2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | potassium 2-(2-hydroxypropanoylamino)-3-sulfidosulfanylpropanoic acid |
| SMILES | CC(O)C(=O)NC(CS[S-])C(=O)O.[K+] |
| InChI | InChI=1S/C6H11NO4S2.K/c1-3(8)5(9)7-4(2-13-12)6(10)11;/h3-4,8,12H,2H2,1H3,(H,7,9)(H,10,11);/q;+1/p-1 |
| InChIKey | AVELXOBIJVHNMJ-UHFFFAOYSA-M |
| XLogP | -3.86 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|