C31H32ClF3N4O3 — CID 164911339
8-chloro-3-methylquinoline-6-carbaldehyde;2-cyclopropyl-N-methyl-2-[3-methyl-7-(2,4,5-trifluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethanamine;hydroxylamine (PubChem CID 164911339) has the molecular formula C31H32ClF3N4O3 and a molecular weight of 601.07 g/mol. Its IUPAC name is 8-chloro-3-methylquinoline-6-carbaldehyde;2-cyclopropyl-N-methyl-2-[3-methyl-7-(2,4,5-trifluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethanamine;hydroxylamine.
| Compound Name | 8-chloro-3-methylquinoline-6-carbaldehyde;2-cyclopropyl-N-methyl-2-[3-methyl-7-(2,4,5-trifluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethanamine;hydroxylamine |
|---|---|
| PubChem CID | 164911339 |
| Molecular Formula | C31H32ClF3N4O3 |
| Molecular Weight | 601.07 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 8-chloro-3-methylquinoline-6-carbaldehyde;2-cyclopropyl-N-methyl-2-[3-methyl-7-(2,4,5-trifluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethanamine;hydroxylamine |
| SMILES | CNCC(c1cc2c(c(-c3cc(F)c(F)cc3F)n1)OCC2C)C1CC1.Cc1cnc2c(Cl)cc(C=O)cc2c1.NO |
| InChI | InChI=1S/C20H21F3N2O.C11H8ClNO.H3NO/c1-10-9-26-20-12(10)6-18(14(8-24-2)11-3-4-11)25-19(20)13-5-16(22)17(23)7-15(13)21;1-7-2-9-3-8(6-14)4-10(12)11(9)13-5-7;1-2/h5-7,10-11,14,24H,3-4,8-9H2,1-2H3;2-6H,1H3;2H,1H2 |
| InChIKey | YNBQTWHBFRRAQM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.07 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|