C20H19ClF2N2O2 — CID 169240887
N-[2-[7-(3-chloro-4,5-difluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]-2-cyclopropylethyl]formamide (PubChem CID 169240887) has the molecular formula C20H19ClF2N2O2 and a molecular weight of 392.83 g/mol. Its IUPAC name is N-[2-[7-(3-chloro-4,5-difluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]-2-cyclopropylethyl]formamide.
| Compound Name | N-[2-[7-(3-chloro-4,5-difluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]-2-cyclopropylethyl]formamide |
|---|---|
| PubChem CID | 169240887 |
| Molecular Formula | C20H19ClF2N2O2 |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[2-[7-(3-chloro-4,5-difluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]-2-cyclopropylethyl]formamide |
| SMILES | CC1COc2c1cc(C(CNC=O)C1CC1)nc2-c1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClF2N2O2/c1-10-8-27-20-13(10)6-17(14(7-24-9-26)11-2-3-11)25-19(20)12-4-15(21)18(23)16(22)5-12/h4-6,9-11,14H,2-3,7-8H2,1H3,(H,24,26) |
| InChIKey | FGBCNZYZDCAZSW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|