C19H20ClF2N3O — CID 169241006
4-(aziridin-2-yl)-2-(4-chloro-2,5-difluorophenyl)-6-[1-cyclopropyl-2-(methylamino)ethyl]pyridin-3-ol (PubChem CID 169241006) has the molecular formula C19H20ClF2N3O and a molecular weight of 379.84 g/mol. Its IUPAC name is 4-(aziridin-2-yl)-2-(4-chloro-2,5-difluorophenyl)-6-[1-cyclopropyl-2-(methylamino)ethyl]pyridin-3-ol.
| Compound Name | 4-(aziridin-2-yl)-2-(4-chloro-2,5-difluorophenyl)-6-[1-cyclopropyl-2-(methylamino)ethyl]pyridin-3-ol |
|---|---|
| PubChem CID | 169241006 |
| Molecular Formula | C19H20ClF2N3O |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 4-(aziridin-2-yl)-2-(4-chloro-2,5-difluorophenyl)-6-[1-cyclopropyl-2-(methylamino)ethyl]pyridin-3-ol |
| SMILES | CNCC(c1cc(C2CN2)c(O)c(-c2cc(F)c(Cl)cc2F)n1)C1CC1 |
| InChI | InChI=1S/C19H20ClF2N3O/c1-23-7-12(9-2-3-9)16-5-11(17-8-24-17)19(26)18(25-16)10-4-15(22)13(20)6-14(10)21/h4-6,9,12,17,23-24,26H,2-3,7-8H2,1H3 |
| InChIKey | JFEXHYVCHDVKBW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|