C30H34N6O3 — CID 164915303
5-[2-[4-[[3-(cyanomethyl)-5-(methoxymethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915303) has the molecular formula C30H34N6O3 and a molecular weight of 526.64 g/mol. Its IUPAC name is 5-[2-[4-[[3-(cyanomethyl)-5-(methoxymethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-(cyanomethyl)-5-(methoxymethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915303 |
| Molecular Formula | C30H34N6O3 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 5-[2-[4-[[3-(cyanomethyl)-5-(methoxymethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | COCc1cc(CC#N)cc(CNCCCCOCCNc2nc3cc(C(N)=O)ccc3c3cnccc23)c1 |
| InChI | InChI=1S/C30H34N6O3/c1-38-20-23-15-21(6-8-31)14-22(16-23)18-33-9-2-3-12-39-13-11-35-30-26-7-10-34-19-27(26)25-5-4-24(29(32)37)17-28(25)36-30/h4-5,7,10,14-17,19,33H,2-3,6,9,11-13,18,20H2,1H3,(H2,32,37)(H,35,36) |
| InChIKey | OHZYECRAEHSCIB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|