C11H13ClN4O2 — CID 164917307
4-(7-chloro-4-methoxy-1H-pyrazolo[5,4-c]pyridin-5-yl)morpholine (PubChem CID 164917307) has the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. Its IUPAC name is 4-(7-chloro-4-methoxy-1H-pyrazolo[5,4-c]pyridin-5-yl)morpholine.
| Compound Name | 4-(7-chloro-4-methoxy-1H-pyrazolo[5,4-c]pyridin-5-yl)morpholine |
|---|---|
| PubChem CID | 164917307 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-(7-chloro-4-methoxy-1H-pyrazolo[5,4-c]pyridin-5-yl)morpholine |
| SMILES | COc1c(N2CCOCC2)nc(Cl)c2[nH]ncc12 |
| InChI | InChI=1S/C11H13ClN4O2/c1-17-9-7-6-13-15-8(7)10(12)14-11(9)16-2-4-18-5-3-16/h6H,2-5H2,1H3,(H,13,15) |
| InChIKey | DVQFVLMZAFYXSD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|