C40H43F2N5O3 — CID 164924019
2-[1-[1-[4-[2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]piperidine-4-carbonyl]piperidin-4-yl]-1,3-dihydroisoindole-5,6-dicarbaldehyde (PubChem CID 164924019) has the molecular formula C40H43F2N5O3 and a molecular weight of 679.81 g/mol. Its IUPAC name is 2-[1-[1-[4-[2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]piperidine-4-carbonyl]piperidin-4-yl]-1,3-dihydroisoindole-5,6-dicarbaldehyde.
| Compound Name | 2-[1-[1-[4-[2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]piperidine-4-carbonyl]piperidin-4-yl]-1,3-dihydroisoindole-5,6-dicarbaldehyde |
|---|---|
| PubChem CID | 164924019 |
| Molecular Formula | C40H43F2N5O3 |
| Molecular Weight | 679.81 g/mol |
| Exact Mass | 679.33 |
| IUPAC Name | 2-[1-[1-[4-[2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]piperidine-4-carbonyl]piperidin-4-yl]-1,3-dihydroisoindole-5,6-dicarbaldehyde |
| SMILES | O=Cc1cc2c(cc1C=O)CN(C1CCN(C(=O)C3CCN(c4ccc(C5c6[nH]c7ccccc7c6CCN5CC(F)F)cc4)CC3)CC1)C2 |
| InChI | InChI=1S/C40H43F2N5O3/c41-37(42)23-46-18-13-35-34-3-1-2-4-36(34)43-38(35)39(46)26-5-7-32(8-6-26)44-14-9-27(10-15-44)40(50)45-16-11-33(12-17-45)47-21-28-19-30(24-48)31(25-49)20-29(28)22-47/h1-8,19-20,24-25,27,33,37,39,43H,9-18,21-23H2 |
| InChIKey | ROYJDYKPPVYLLV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.81 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|